C26H28F2O2 — CID 89181601
1-[2-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]phenyl]butan-1-ol (PubChem CID 89181601) has the molecular formula C26H28F2O2 and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-[2-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]phenyl]butan-1-ol.
| Compound Name | 1-[2-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 89181601 |
| Molecular Formula | C26H28F2O2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[2-fluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]-1,2,3,3a,6,6a-hexahydropentalen-1-yl]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C2CCC3C(c4ccc(C5CO5)c(F)c4)=CCC32)cc1F |
| InChI | InChI=1S/C26H28F2O2/c1-2-3-25(29)21-6-4-15(12-23(21)27)17-8-10-20-18(9-11-19(17)20)16-5-7-22(24(28)13-16)26-14-30-26/h4-7,9,12-13,17,19-20,25-26,29H,2-3,8,10-11,14H2,1H3 |
| InChIKey | RHLHSYHZANLECW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|