C25H19F7O4 — CID 162567693
(4-ethoxy-3-fluorophenyl) 7-ethoxy-1,8,9,9,10,10-hexafluoro-1,2-dihydrophenanthrene-2-carboxylate (PubChem CID 162567693) has the molecular formula C25H19F7O4 and a molecular weight of 516.41 g/mol. Its IUPAC name is (4-ethoxy-3-fluorophenyl) 7-ethoxy-1,8,9,9,10,10-hexafluoro-1,2-dihydrophenanthrene-2-carboxylate.
| Compound Name | (4-ethoxy-3-fluorophenyl) 7-ethoxy-1,8,9,9,10,10-hexafluoro-1,2-dihydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 162567693 |
| Molecular Formula | C25H19F7O4 |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | (4-ethoxy-3-fluorophenyl) 7-ethoxy-1,8,9,9,10,10-hexafluoro-1,2-dihydrophenanthrene-2-carboxylate |
| SMILES | CCOc1ccc(OC(=O)C2C=CC3=C(C2F)C(F)(F)C(F)(F)c2c3ccc(OCC)c2F)cc1F |
| InChI | InChI=1S/C25H19F7O4/c1-3-34-17-9-5-12(11-16(17)26)36-23(33)15-7-6-13-14-8-10-18(35-4-2)22(28)20(14)25(31,32)24(29,30)19(13)21(15)27/h5-11,15,21H,3-4H2,1-2H3 |
| InChIKey | BGNGSPAOHFQMMP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|