C31H35F3 — CID 143772530
1-[4-[5,6-difluoro-4-[(Z)-hex-4-enyl]cyclohexa-1,3-dien-1-yl]phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene (PubChem CID 143772530) has the molecular formula C31H35F3 and a molecular weight of 464.62 g/mol. Its IUPAC name is 1-[4-[5,6-difluoro-4-[(Z)-hex-4-enyl]cyclohexa-1,3-dien-1-yl]phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene.
| Compound Name | 1-[4-[5,6-difluoro-4-[(Z)-hex-4-enyl]cyclohexa-1,3-dien-1-yl]phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143772530 |
| Molecular Formula | C31H35F3 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-[4-[5,6-difluoro-4-[(Z)-hex-4-enyl]cyclohexa-1,3-dien-1-yl]phenyl]-2-fluoro-4-(4-methylcyclohexyl)benzene |
| SMILES | C/C=C\CCCC1=CC=C(c2ccc(-c3ccc(C4CCC(C)CC4)cc3F)cc2)C(F)C1F |
| InChI | InChI=1S/C31H35F3/c1-3-4-5-6-7-25-16-19-28(31(34)30(25)33)24-14-12-23(13-15-24)27-18-17-26(20-29(27)32)22-10-8-21(2)9-11-22/h3-4,12-22,30-31H,5-11H2,1-2H3/b4-3- |
| InChIKey | UTCUWLBIIZHDKM-ARJAWSKDSA-N |
| XLogP | 9.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|