C27H27F3O2 — CID 143772839
5-but-3-enyl-2-[4-[4-(5,6-difluoro-4-methylcyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-1,3-dioxane (PubChem CID 143772839) has the molecular formula C27H27F3O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(5,6-difluoro-4-methylcyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(5,6-difluoro-4-methylcyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 143772839 |
| Molecular Formula | C27H27F3O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(5,6-difluoro-4-methylcyclohexa-1,3-dien-1-yl)phenyl]-3-fluorophenyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(c2ccc(-c3ccc(C4=CC=C(C)C(F)C4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C27H27F3O2/c1-3-4-5-18-15-31-27(32-16-18)21-11-13-22(24(28)14-21)19-7-9-20(10-8-19)23-12-6-17(2)25(29)26(23)30/h3,6-14,18,25-27H,1,4-5,15-16H2,2H3 |
| InChIKey | DMIKOAUCVPUVSG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|