C23H25F3O — CID 126765211
5-[2,3-difluoro-4-(2-fluoro-4-propylphenyl)phenyl]-2-[(E)-prop-1-enyl]oxane (PubChem CID 126765211) has the molecular formula C23H25F3O and a molecular weight of 374.45 g/mol. Its IUPAC name is 5-[2,3-difluoro-4-(2-fluoro-4-propylphenyl)phenyl]-2-[(E)-prop-1-enyl]oxane.
| Compound Name | 5-[2,3-difluoro-4-(2-fluoro-4-propylphenyl)phenyl]-2-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 126765211 |
| Molecular Formula | C23H25F3O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 5-[2,3-difluoro-4-(2-fluoro-4-propylphenyl)phenyl]-2-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/C1CCC(c2ccc(-c3ccc(CCC)cc3F)c(F)c2F)CO1 |
| InChI | InChI=1S/C23H25F3O/c1-3-5-15-7-10-19(21(24)13-15)20-12-11-18(22(25)23(20)26)16-8-9-17(6-4-2)27-14-16/h4,6-7,10-13,16-17H,3,5,8-9,14H2,1-2H3/b6-4+ |
| InChIKey | IKWCZBQNSRJOEB-GQCTYLIASA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|