C30H30F4O — CID 58535362
5-[4-[2,3-difluoro-4-[2-(4-propylphenyl)ethyl]phenyl]-2,3-difluorophenyl]-2-ethenyloxane (PubChem CID 58535362) has the molecular formula C30H30F4O and a molecular weight of 482.56 g/mol. Its IUPAC name is 5-[4-[2,3-difluoro-4-[2-(4-propylphenyl)ethyl]phenyl]-2,3-difluorophenyl]-2-ethenyloxane.
| Compound Name | 5-[4-[2,3-difluoro-4-[2-(4-propylphenyl)ethyl]phenyl]-2,3-difluorophenyl]-2-ethenyloxane |
|---|---|
| PubChem CID | 58535362 |
| Molecular Formula | C30H30F4O |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 5-[4-[2,3-difluoro-4-[2-(4-propylphenyl)ethyl]phenyl]-2,3-difluorophenyl]-2-ethenyloxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(CCc4ccc(CCC)cc4)c(F)c3F)c(F)c2F)CO1 |
| InChI | InChI=1S/C30H30F4O/c1-3-5-19-6-8-20(9-7-19)10-11-21-13-15-25(29(33)27(21)31)26-17-16-24(28(32)30(26)34)22-12-14-23(4-2)35-18-22/h4,6-9,13,15-17,22-23H,2-3,5,10-12,14,18H2,1H3 |
| InChIKey | KHNXQBNCGXYLOM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|