C39H47FO7 — CID 145412060
[(3R)-3-[4-[5-[3-fluoro-4-(4-pentylphenyl)phenyl]-1,3-dioxan-2-yl]phenyl]-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxy-2-methylpropanoate (PubChem CID 145412060) has the molecular formula C39H47FO7 and a molecular weight of 646.80 g/mol. Its IUPAC name is [(3R)-3-[4-[5-[3-fluoro-4-(4-pentylphenyl)phenyl]-1,3-dioxan-2-yl]phenyl]-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxy-2-methylpropanoate.
| Compound Name | [(3R)-3-[4-[5-[3-fluoro-4-(4-pentylphenyl)phenyl]-1,3-dioxan-2-yl]phenyl]-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 145412060 |
| Molecular Formula | C39H47FO7 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | [(3R)-3-[4-[5-[3-fluoro-4-(4-pentylphenyl)phenyl]-1,3-dioxan-2-yl]phenyl]-4-(2-methylprop-2-enoyloxy)butyl] 3-hydroxy-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OC[C@H](CCOC(=O)C(C)CO)c1ccc(C2OCC(c3ccc(-c4ccc(CCCCC)cc4)c(F)c3)CO2)cc1 |
| InChI | InChI=1S/C39H47FO7/c1-5-6-7-8-28-9-11-30(12-10-28)35-18-17-32(21-36(35)40)34-24-46-39(47-25-34)31-15-13-29(14-16-31)33(23-45-37(42)26(2)3)19-20-44-38(43)27(4)22-41/h9-18,21,27,33-34,39,41H,2,5-8,19-20,22-25H2,1,3-4H3/t27?,33-,34?,39?/m0/s1 |
| InChIKey | HEKXHGMYBGWJFE-ZSGRSKKBSA-N |
| XLogP | 7.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|