C30H40O8 — CID 139525163
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[(Z)-2-(4-pentylcyclohexa-1,3-dien-1-yl)oxyethenoxy]phenyl]propyl] 3-hydroxy-2-methylpropanoate (PubChem CID 139525163) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[(Z)-2-(4-pentylcyclohexa-1,3-dien-1-yl)oxyethenoxy]phenyl]propyl] 3-hydroxy-2-methylpropanoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[(Z)-2-(4-pentylcyclohexa-1,3-dien-1-yl)oxyethenoxy]phenyl]propyl] 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 139525163 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[4-[(Z)-2-(4-pentylcyclohexa-1,3-dien-1-yl)oxyethenoxy]phenyl]propyl] 3-hydroxy-2-methylpropanoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(C)CO)c1ccc(O/C=C\OC2=CC=C(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C30H40O8/c1-4-5-6-7-24-8-12-27(13-9-24)35-16-17-36-28-14-10-25(11-15-28)26(20-37-29(33)22(2)18-31)21-38-30(34)23(3)19-32/h8,10-12,14-17,23,26,31-32H,2,4-7,9,13,18-21H2,1,3H3/b17-16- |
| InChIKey | PUYHZSWJOPVSMD-MSUUIHNZSA-N |
| XLogP | 5.08 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|