C29H38O8 — CID 134245685
2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]phenoxy]ethyl 3-hydroxy-2-methylpropanoate (PubChem CID 134245685) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]phenoxy]ethyl 3-hydroxy-2-methylpropanoate.
| Compound Name | 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]phenoxy]ethyl 3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 134245685 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2-[4-[4-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-pentylphenyl]phenoxy]ethyl 3-hydroxy-2-methylpropanoate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(OCCOC(=O)C(C)CO)cc2)c(CCCCC)c1 |
| InChI | InChI=1S/C29H38O8/c1-4-5-6-7-24-18-26(35-15-17-37-29(33)22(3)20-31)12-13-27(24)23-8-10-25(11-9-23)34-14-16-36-28(32)21(2)19-30/h8-13,18,21,30-31H,3-7,14-17,19-20H2,1-2H3 |
| InChIKey | AODSGLHPYNCAAS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|