C34H42O5 — CID 142282855
2-[4-[3-heptyl-4-[3-[3-(hydroxymethyl)but-3-enoxy]phenyl]phenyl]phenoxy]ethyl acetate (PubChem CID 142282855) has the molecular formula C34H42O5 and a molecular weight of 530.71 g/mol. Its IUPAC name is 2-[4-[3-heptyl-4-[3-[3-(hydroxymethyl)but-3-enoxy]phenyl]phenyl]phenoxy]ethyl acetate.
| Compound Name | 2-[4-[3-heptyl-4-[3-[3-(hydroxymethyl)but-3-enoxy]phenyl]phenyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 142282855 |
| Molecular Formula | C34H42O5 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[4-[3-heptyl-4-[3-[3-(hydroxymethyl)but-3-enoxy]phenyl]phenyl]phenoxy]ethyl acetate |
| SMILES | C=C(CO)CCOc1cccc(-c2ccc(-c3ccc(OCCOC(C)=O)cc3)cc2CCCCCCC)c1 |
| InChI | InChI=1S/C34H42O5/c1-4-5-6-7-8-10-30-23-29(28-13-16-32(17-14-28)39-22-21-37-27(3)36)15-18-34(30)31-11-9-12-33(24-31)38-20-19-26(2)25-35/h9,11-18,23-24,35H,2,4-8,10,19-22,25H2,1,3H3 |
| InChIKey | WLHNKVZVTDTSKC-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|