C38H41FO8 — CID 142283087
[3-[4-[4-[2-fluoro-5-[2-(hydroxymethyl)prop-2-enoxyperoxy]phenyl]-2-pentylphenyl]phenyl]phenyl] ethaneperoxoate;prop-2-en-1-ol (PubChem CID 142283087) has the molecular formula C38H41FO8 and a molecular weight of 644.74 g/mol. Its IUPAC name is [3-[4-[4-[2-fluoro-5-[2-(hydroxymethyl)prop-2-enoxyperoxy]phenyl]-2-pentylphenyl]phenyl]phenyl] ethaneperoxoate;prop-2-en-1-ol.
| Compound Name | [3-[4-[4-[2-fluoro-5-[2-(hydroxymethyl)prop-2-enoxyperoxy]phenyl]-2-pentylphenyl]phenyl]phenyl] ethaneperoxoate;prop-2-en-1-ol |
|---|---|
| PubChem CID | 142283087 |
| Molecular Formula | C38H41FO8 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [3-[4-[4-[2-fluoro-5-[2-(hydroxymethyl)prop-2-enoxyperoxy]phenyl]-2-pentylphenyl]phenyl]phenyl] ethaneperoxoate;prop-2-en-1-ol |
| SMILES | C=C(CO)COOOc1ccc(F)c(-c2ccc(-c3ccc(-c4cccc(OOC(C)=O)c4)cc3)c(CCCCC)c2)c1.C=CCO |
| InChI | InChI=1S/C35H35FO7.C3H6O/c1-4-5-6-8-29-19-30(34-21-32(16-18-35(34)36)42-43-39-23-24(2)22-37)15-17-33(29)27-13-11-26(12-14-27)28-9-7-10-31(20-28)41-40-25(3)38;1-2-3-4/h7,9-21,37H,2,4-6,8,22-23H2,1,3H3;2,4H,1,3H2 |
| InChIKey | MKJUOJOZVGMNIV-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|