C33H43FO8 — CID 134246307
2-[3-[3-fluoro-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-nonylphenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246307) has the molecular formula C33H43FO8 and a molecular weight of 586.70 g/mol. Its IUPAC name is 2-[3-[3-fluoro-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-nonylphenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[3-fluoro-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-nonylphenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246307 |
| Molecular Formula | C33H43FO8 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | 2-[3-[3-fluoro-5-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]-2-nonylphenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1cccc(-c2cc(OCCOC(=O)C(=C)CO)cc(F)c2CCCCCCCCC)c1 |
| InChI | InChI=1S/C33H43FO8/c1-4-5-6-7-8-9-10-14-29-30(20-28(21-31(29)34)40-16-18-42-33(38)25(3)23-36)26-12-11-13-27(19-26)39-15-17-41-32(37)24(2)22-35/h11-13,19-21,35-36H,2-10,14-18,22-23H2,1H3 |
| InChIKey | CZBXWNINDFIDDZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|