C28H29FO5 — CID 135247654
2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135247654) has the molecular formula C28H29FO5 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135247654 |
| Molecular Formula | C28H29FO5 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[4-[2-(4-fluorobutyl)-4-(4-hydroxyphenyl)phenyl]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(O)cc3)cc2CCCCF)cc1 |
| InChI | InChI=1S/C28H29FO5/c1-20(19-30)28(32)34-17-16-33-26-12-7-22(8-13-26)27-14-9-23(18-24(27)4-2-3-15-29)21-5-10-25(31)11-6-21/h5-14,18,30-31H,1-4,15-17,19H2 |
| InChIKey | AEFCGNJQCPMBJS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|