C36H36F4O10 — CID 135172821
[4-[3,5-bis[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl] 3-fluoro-4-(5,5,5-trifluoropentyl)benzoate (PubChem CID 135172821) has the molecular formula C36H36F4O10 and a molecular weight of 704.67 g/mol. Its IUPAC name is [4-[3,5-bis[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl] 3-fluoro-4-(5,5,5-trifluoropentyl)benzoate.
| Compound Name | [4-[3,5-bis[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl] 3-fluoro-4-(5,5,5-trifluoropentyl)benzoate |
|---|---|
| PubChem CID | 135172821 |
| Molecular Formula | C36H36F4O10 |
| Molecular Weight | 704.67 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | [4-[3,5-bis[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenyl]phenyl] 3-fluoro-4-(5,5,5-trifluoropentyl)benzoate |
| SMILES | C=C(CO)C(=O)OCCOc1cc(OCCOC(=O)C(=C)CO)cc(-c2ccc(OC(=O)c3ccc(CCCCC(F)(F)F)c(F)c3)cc2)c1 |
| InChI | InChI=1S/C36H36F4O10/c1-23(21-41)33(43)48-15-13-46-30-17-28(18-31(20-30)47-14-16-49-34(44)24(2)22-42)25-8-10-29(11-9-25)50-35(45)27-7-6-26(32(37)19-27)5-3-4-12-36(38,39)40/h6-11,17-20,41-42H,1-5,12-16,21-22H2 |
| InChIKey | VHTXJHCSTMFHLA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|