C35H52O4 — CID 172861784
4-decoxy-2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]benzoic acid (PubChem CID 172861784) has the molecular formula C35H52O4 and a molecular weight of 536.80 g/mol. Its IUPAC name is 4-decoxy-2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]benzoic acid.
| Compound Name | 4-decoxy-2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 172861784 |
| Molecular Formula | C35H52O4 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | 4-decoxy-2-[4-[3-(4-propylcyclohexyl)propoxy]phenyl]benzoic acid |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)O)c(-c2ccc(OCCCC3CCC(CCC)CC3)cc2)c1 |
| InChI | InChI=1S/C35H52O4/c1-3-5-6-7-8-9-10-11-25-39-32-23-24-33(35(36)37)34(27-32)30-19-21-31(22-20-30)38-26-12-14-29-17-15-28(13-4-2)16-18-29/h19-24,27-29H,3-18,25-26H2,1-2H3,(H,36,37) |
| InChIKey | ZLIATJAFYHCFPK-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|