C30H42O4 — CID 172812929
2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-4-propoxybenzoic acid (PubChem CID 172812929) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is 2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-4-propoxybenzoic acid.
| Compound Name | 2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-4-propoxybenzoic acid |
|---|---|
| PubChem CID | 172812929 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-4-propoxybenzoic acid |
| SMILES | CCCCCC1CCC(CCCOc2ccc(-c3cc(OCCC)ccc3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C30H42O4/c1-3-5-6-8-23-10-12-24(13-11-23)9-7-21-34-26-16-14-25(15-17-26)29-22-27(33-20-4-2)18-19-28(29)30(31)32/h14-19,22-24H,3-13,20-21H2,1-2H3,(H,31,32) |
| InChIKey | SKTUFIMIQDJEAR-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|