C27H33IO3 — CID 67945830
(4-iodophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate (PubChem CID 67945830) has the molecular formula C27H33IO3 and a molecular weight of 532.46 g/mol. Its IUPAC name is (4-iodophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate.
| Compound Name | (4-iodophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate |
|---|---|
| PubChem CID | 67945830 |
| Molecular Formula | C27H33IO3 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (4-iodophenyl) 4-[(E)-3-(4-pentylcyclohexyl)prop-2-enoxy]benzoate |
| SMILES | CCCCCC1CCC(/C=C/COc2ccc(C(=O)Oc3ccc(I)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H33IO3/c1-2-3-4-6-21-8-10-22(11-9-21)7-5-20-30-25-16-12-23(13-17-25)27(29)31-26-18-14-24(28)15-19-26/h5,7,12-19,21-22H,2-4,6,8-11,20H2,1H3/b7-5+ |
| InChIKey | DWZJZDIRHICYAS-FNORWQNLSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|