C20H29ClO — CID 57271529
1-chloro-4-[3-(4-pentylcyclohexyl)prop-2-enoxy]benzene (PubChem CID 57271529) has the molecular formula C20H29ClO and a molecular weight of 320.90 g/mol. Its IUPAC name is 1-chloro-4-[3-(4-pentylcyclohexyl)prop-2-enoxy]benzene.
| Compound Name | 1-chloro-4-[3-(4-pentylcyclohexyl)prop-2-enoxy]benzene |
|---|---|
| PubChem CID | 57271529 |
| Molecular Formula | C20H29ClO |
| Molecular Weight | 320.90 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-chloro-4-[3-(4-pentylcyclohexyl)prop-2-enoxy]benzene |
| SMILES | CCCCCC1CCC(C=CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H29ClO/c1-2-3-4-6-17-8-10-18(11-9-17)7-5-16-22-20-14-12-19(21)13-15-20/h5,7,12-15,17-18H,2-4,6,8-11,16H2,1H3 |
| InChIKey | DMUOEFJRCSVISO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.90 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|