C28H44O3 — CID 19818111
5-hexyl-2-[4-[(E)-3-(4-propylcyclohexyl)prop-2-enoxy]phenyl]-1,3-dioxane (PubChem CID 19818111) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 5-hexyl-2-[4-[(E)-3-(4-propylcyclohexyl)prop-2-enoxy]phenyl]-1,3-dioxane.
| Compound Name | 5-hexyl-2-[4-[(E)-3-(4-propylcyclohexyl)prop-2-enoxy]phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19818111 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 5-hexyl-2-[4-[(E)-3-(4-propylcyclohexyl)prop-2-enoxy]phenyl]-1,3-dioxane |
| SMILES | CCCCCCC1COC(c2ccc(OC/C=C/C3CCC(CCC)CC3)cc2)OC1 |
| InChI | InChI=1S/C28H44O3/c1-3-5-6-7-10-25-21-30-28(31-22-25)26-16-18-27(19-17-26)29-20-8-11-24-14-12-23(9-4-2)13-15-24/h8,11,16-19,23-25,28H,3-7,9-10,12-15,20-22H2,1-2H3/b11-8+ |
| InChIKey | GSBBYDHYPMPTPF-DHZHZOJOSA-N |
| XLogP | 7.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|