C23H25NO2S2 — CID 71413822
[4-(5-pentyl-1,3-dithian-2-yl)phenyl] 4-cyanobenzoate (PubChem CID 71413822) has the molecular formula C23H25NO2S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is [4-(5-pentyl-1,3-dithian-2-yl)phenyl] 4-cyanobenzoate.
| Compound Name | [4-(5-pentyl-1,3-dithian-2-yl)phenyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 71413822 |
| Molecular Formula | C23H25NO2S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [4-(5-pentyl-1,3-dithian-2-yl)phenyl] 4-cyanobenzoate |
| SMILES | CCCCCC1CSC(c2ccc(OC(=O)c3ccc(C#N)cc3)cc2)SC1 |
| InChI | InChI=1S/C23H25NO2S2/c1-2-3-4-5-18-15-27-23(28-16-18)20-10-12-21(13-11-20)26-22(25)19-8-6-17(14-24)7-9-19/h6-13,18,23H,2-5,15-16H2,1H3 |
| InChIKey | PMCLHVGUAADXQO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|