C31H42N2O2 — CID 56624496
[2,3-dicyano-4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl] 4-propylcyclohexane-1-carboxylate (PubChem CID 56624496) has the molecular formula C31H42N2O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is [2,3-dicyano-4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl] 4-propylcyclohexane-1-carboxylate.
| Compound Name | [2,3-dicyano-4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl] 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 56624496 |
| Molecular Formula | C31H42N2O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | [2,3-dicyano-4-(4-pentyl-1-bicyclo[2.2.2]octanyl)phenyl] 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCCCC12CCC(c3ccc(OC(=O)C4CCC(CCC)CC4)c(C#N)c3C#N)(CC1)CC2 |
| InChI | InChI=1S/C31H42N2O2/c1-3-5-6-14-30-15-18-31(19-16-30,20-17-30)27-12-13-28(26(22-33)25(27)21-32)35-29(34)24-10-8-23(7-4-2)9-11-24/h12-13,23-24H,3-11,14-20H2,1-2H3 |
| InChIKey | XSXMWHGLGBFLDE-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|