C32H40N2O4S2 — CID 89027883
[4-(4-butylcyclohexanecarbonyl)oxy-2-(dicyanomethylidene)-1,3-benzodithiol-7-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 89027883) has the molecular formula C32H40N2O4S2 and a molecular weight of 580.82 g/mol. Its IUPAC name is [4-(4-butylcyclohexanecarbonyl)oxy-2-(dicyanomethylidene)-1,3-benzodithiol-7-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [4-(4-butylcyclohexanecarbonyl)oxy-2-(dicyanomethylidene)-1,3-benzodithiol-7-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89027883 |
| Molecular Formula | C32H40N2O4S2 |
| Molecular Weight | 580.82 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | [4-(4-butylcyclohexanecarbonyl)oxy-2-(dicyanomethylidene)-1,3-benzodithiol-7-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(CCCC)CC3)c3c2SC(=C(C#N)C#N)S3)CC1 |
| InChI | InChI=1S/C32H40N2O4S2/c1-3-5-7-21-9-13-23(14-10-21)30(35)37-26-17-18-27(29-28(26)39-32(40-29)25(19-33)20-34)38-31(36)24-15-11-22(12-16-24)8-6-4-2/h17-18,21-24H,3-16H2,1-2H3 |
| InChIKey | TZLLIYZVWHTAFC-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.82 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|