C15H10N2O4S2 — CID 88877163
[7-acetyloxy-2-(dicyanomethylidene)-1,3-benzodithiol-4-yl] propanoate (PubChem CID 88877163) has the molecular formula C15H10N2O4S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is [7-acetyloxy-2-(dicyanomethylidene)-1,3-benzodithiol-4-yl] propanoate.
| Compound Name | [7-acetyloxy-2-(dicyanomethylidene)-1,3-benzodithiol-4-yl] propanoate |
|---|---|
| PubChem CID | 88877163 |
| Molecular Formula | C15H10N2O4S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | [7-acetyloxy-2-(dicyanomethylidene)-1,3-benzodithiol-4-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc(OC(C)=O)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C15H10N2O4S2/c1-3-12(19)21-11-5-4-10(20-8(2)18)13-14(11)23-15(22-13)9(6-16)7-17/h4-5H,3H2,1-2H3 |
| InChIKey | ZBVKIMATYKSGMG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|