C34H36N2O12S2 — CID 154953633
4-O-[2-(dicyanomethylidene)-4-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxy-1,3-benzodithiol-7-yl] 1-O-(2,2-dimethyl-3-prop-2-enoyloxypropyl) butanedioate (PubChem CID 154953633) has the molecular formula C34H36N2O12S2 and a molecular weight of 728.80 g/mol. Its IUPAC name is 4-O-[2-(dicyanomethylidene)-4-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxy-1,3-benzodithiol-7-yl] 1-O-(2,2-dimethyl-3-prop-2-enoyloxypropyl) butanedioate.
| Compound Name | 4-O-[2-(dicyanomethylidene)-4-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxy-1,3-benzodithiol-7-yl] 1-O-(2,2-dimethyl-3-prop-2-enoyloxypropyl) butanedioate |
|---|---|
| PubChem CID | 154953633 |
| Molecular Formula | C34H36N2O12S2 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 728.17 |
| IUPAC Name | 4-O-[2-(dicyanomethylidene)-4-[4-(2,2-dimethyl-3-prop-2-enoyloxypropoxy)-4-oxobutanoyl]oxy-1,3-benzodithiol-7-yl] 1-O-(2,2-dimethyl-3-prop-2-enoyloxypropyl) butanedioate |
| SMILES | C=CC(=O)OCC(C)(C)COC(=O)CCC(=O)Oc1ccc(OC(=O)CCC(=O)OCC(C)(C)COC(=O)C=C)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C34H36N2O12S2/c1-7-24(37)43-17-33(3,4)19-45-26(39)11-13-28(41)47-22-9-10-23(31-30(22)49-32(50-31)21(15-35)16-36)48-29(42)14-12-27(40)46-20-34(5,6)18-44-25(38)8-2/h7-10H,1-2,11-14,17-20H2,3-6H3 |
| InChIKey | PENHTDYFXPQLIV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 205.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|