About [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate
[2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate (PubChem CID 59171635) has the molecular formula C26H32N2O4S2
and a molecular weight of 500.69 g/mol. Its IUPAC name is [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate.
Molecular Properties
| Compound Name | [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
| PubChem CID | 59171635 |
| Molecular Formula | C26H32N2O4S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ccc(OC(=O)C(CC)CCCC)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C26H32N2O4S2/c1-5-9-11-17(7-3)24(29)31-20-13-14-21(32-25(30)18(8-4)12-10-6-2)23-22(20)33-26(34-23)19(15-27)16-28/h13-14,17-18H,5-12H2,1-4H3 |
| InChIKey | ILRVFLKUTVBBDE-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate?
The IUPAC name of [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate (CID 59171635) is [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate.
What is the SMILES notation for [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate?
The canonical SMILES for [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate is CCCCC(CC)C(=O)Oc1ccc(OC(=O)C(CC)CCCC)c2c1SC(=C(C#N)C#N)S2.
What is the InChIKey of [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate?
The InChIKey is ILRVFLKUTVBBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O4S2/c1-5-9-11-17(7-3)24(29)31-20-13-14-21(32-25(30)18(8-4)12-10-6-2)23-22(20)33-26(34-23)19(15-27)16-28/h13-14,17-18H,5-12H2,1-4H3.
What are the key properties of [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate?
[2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate has a molecular weight of 500.69 g/mol, XLogP of 7.39, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate is sourced from PubChem (CID 59171635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).