C28H38N2O5S2 — CID 58176373
[2-[1-cyano-2-(dimethylamino)-2-oxoethylidene]-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate (PubChem CID 58176373) has the molecular formula C28H38N2O5S2 and a molecular weight of 546.76 g/mol. Its IUPAC name is [2-[1-cyano-2-(dimethylamino)-2-oxoethylidene]-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate.
| Compound Name | [2-[1-cyano-2-(dimethylamino)-2-oxoethylidene]-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 58176373 |
| Molecular Formula | C28H38N2O5S2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [2-[1-cyano-2-(dimethylamino)-2-oxoethylidene]-4-(2-ethylhexanoyloxy)-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ccc(OC(=O)C(CC)CCCC)c2c1SC(=C(C#N)C(=O)N(C)C)S2 |
| InChI | InChI=1S/C28H38N2O5S2/c1-7-11-13-18(9-3)26(32)34-21-15-16-22(35-27(33)19(10-4)14-12-8-2)24-23(21)36-28(37-24)20(17-29)25(31)30(5)6/h15-16,18-19H,7-14H2,1-6H3 |
| InChIKey | IZTIOQGIRBEKEN-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|