C33H38N6O3S2 — CID 89082520
[2,6-bis(dicyanomethylidene)-8-(3-ethyl-2-oxoheptyl)-3,7-dimethyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl] 2-ethylhexanoate (PubChem CID 89082520) has the molecular formula C33H38N6O3S2 and a molecular weight of 630.84 g/mol. Its IUPAC name is [2,6-bis(dicyanomethylidene)-8-(3-ethyl-2-oxoheptyl)-3,7-dimethyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl] 2-ethylhexanoate.
| Compound Name | [2,6-bis(dicyanomethylidene)-8-(3-ethyl-2-oxoheptyl)-3,7-dimethyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 89082520 |
| Molecular Formula | C33H38N6O3S2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | [2,6-bis(dicyanomethylidene)-8-(3-ethyl-2-oxoheptyl)-3,7-dimethyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Cc1c2c(c(OC(=O)C(CC)CCCC)c3c1N(C)C(=C(C#N)C#N)S3)N(C)C(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C33H38N6O3S2/c1-7-11-13-20(9-3)25(40)15-24-26-30(44-31(38(26)5)22(16-34)17-35)28(42-33(41)21(10-4)14-12-8-2)27-29(24)43-32(39(27)6)23(18-36)19-37/h20-21H,7-15H2,1-6H3 |
| InChIKey | ORMWDJNGBRVXIW-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 145.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|