C28H36N2O4S2 — CID 168852365
[2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-5,6-dimethyl-1,3-benzodithiol-7-yl] 2-ethylhexanoate (PubChem CID 168852365) has the molecular formula C28H36N2O4S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-5,6-dimethyl-1,3-benzodithiol-7-yl] 2-ethylhexanoate.
| Compound Name | [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-5,6-dimethyl-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 168852365 |
| Molecular Formula | C28H36N2O4S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [2-(dicyanomethylidene)-4-(2-ethylhexanoyloxy)-5,6-dimethyl-1,3-benzodithiol-7-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c(C)c(C)c(OC(=O)C(CC)CCCC)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C28H36N2O4S2/c1-7-11-13-19(9-3)26(31)33-22-17(5)18(6)23(34-27(32)20(10-4)14-12-8-2)25-24(22)35-28(36-25)21(15-29)16-30/h19-20H,7-14H2,1-6H3 |
| InChIKey | LQUPRKIQERMBHS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|