C32H44N2O4S2 — CID 170016811
[5-butyl-2-(dicyanomethylidene)-4-(3,5,5-trimethylhexanoyloxy)-1,3-benzodithiol-7-yl] 3,5,5-trimethylhexanoate (PubChem CID 170016811) has the molecular formula C32H44N2O4S2 and a molecular weight of 584.85 g/mol. Its IUPAC name is [5-butyl-2-(dicyanomethylidene)-4-(3,5,5-trimethylhexanoyloxy)-1,3-benzodithiol-7-yl] 3,5,5-trimethylhexanoate.
| Compound Name | [5-butyl-2-(dicyanomethylidene)-4-(3,5,5-trimethylhexanoyloxy)-1,3-benzodithiol-7-yl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 170016811 |
| Molecular Formula | C32H44N2O4S2 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | [5-butyl-2-(dicyanomethylidene)-4-(3,5,5-trimethylhexanoyloxy)-1,3-benzodithiol-7-yl] 3,5,5-trimethylhexanoate |
| SMILES | CCCCc1cc(OC(=O)CC(C)CC(C)(C)C)c2c(c1OC(=O)CC(C)CC(C)(C)C)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C32H44N2O4S2/c1-10-11-12-22-15-24(37-25(35)13-20(2)16-31(4,5)6)28-29(40-30(39-28)23(18-33)19-34)27(22)38-26(36)14-21(3)17-32(7,8)9/h15,20-21H,10-14,16-17H2,1-9H3 |
| InChIKey | GQIDOMPYNIVONA-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|