C47H74N2O4S2 — CID 168852408
[2-(dicyanomethylidene)-5-methyl-4-(2-octyldecanoyloxy)-1,3-benzodithiol-7-yl] 2-octyldecanoate (PubChem CID 168852408) has the molecular formula C47H74N2O4S2 and a molecular weight of 795.25 g/mol. Its IUPAC name is [2-(dicyanomethylidene)-5-methyl-4-(2-octyldecanoyloxy)-1,3-benzodithiol-7-yl] 2-octyldecanoate.
| Compound Name | [2-(dicyanomethylidene)-5-methyl-4-(2-octyldecanoyloxy)-1,3-benzodithiol-7-yl] 2-octyldecanoate |
|---|---|
| PubChem CID | 168852408 |
| Molecular Formula | C47H74N2O4S2 |
| Molecular Weight | 795.25 g/mol |
| Exact Mass | 794.51 |
| IUPAC Name | [2-(dicyanomethylidene)-5-methyl-4-(2-octyldecanoyloxy)-1,3-benzodithiol-7-yl] 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)Oc1cc(C)c(OC(=O)C(CCCCCCCC)CCCCCCCC)c2c1SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C47H74N2O4S2/c1-6-10-14-18-22-26-30-38(31-27-23-19-15-11-7-2)45(50)52-41-34-37(5)42(44-43(41)54-47(55-44)40(35-48)36-49)53-46(51)39(32-28-24-20-16-12-8-3)33-29-25-21-17-13-9-4/h34,38-39H,6-33H2,1-5H3 |
| InChIKey | LLLUMORBQAINCD-UHFFFAOYSA-N |
| XLogP | 15.50 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.25 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|