C35H50N2O8S2 — CID 167239986
3-hydroxypropyl 9-[[2-(dicyanomethylidene)-4-[9-(3-hydroxypropoxy)-9-oxononoxy]-5-methyl-1,3-benzodithiol-7-yl]oxy]nonanoate (PubChem CID 167239986) has the molecular formula C35H50N2O8S2 and a molecular weight of 690.93 g/mol. Its IUPAC name is 3-hydroxypropyl 9-[[2-(dicyanomethylidene)-4-[9-(3-hydroxypropoxy)-9-oxononoxy]-5-methyl-1,3-benzodithiol-7-yl]oxy]nonanoate.
| Compound Name | 3-hydroxypropyl 9-[[2-(dicyanomethylidene)-4-[9-(3-hydroxypropoxy)-9-oxononoxy]-5-methyl-1,3-benzodithiol-7-yl]oxy]nonanoate |
|---|---|
| PubChem CID | 167239986 |
| Molecular Formula | C35H50N2O8S2 |
| Molecular Weight | 690.93 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | 3-hydroxypropyl 9-[[2-(dicyanomethylidene)-4-[9-(3-hydroxypropoxy)-9-oxononoxy]-5-methyl-1,3-benzodithiol-7-yl]oxy]nonanoate |
| SMILES | Cc1cc(OCCCCCCCCC(=O)OCCCO)c2c(c1OCCCCCCCCC(=O)OCCCO)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C35H50N2O8S2/c1-27-24-29(42-20-12-8-4-2-6-10-16-30(40)43-22-14-18-38)33-34(47-35(46-33)28(25-36)26-37)32(27)45-21-13-9-5-3-7-11-17-31(41)44-23-15-19-39/h24,38-39H,2-23H2,1H3 |
| InChIKey | DXTMYRKREPVSAH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.93 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|