C29H38N2O7S2 — CID 176804742
2-[2-[[(2E)-2-[cyano(isocyano)methylidene]-5-methyl-7-[2-(4-methyl-3-oxohexoxy)ethoxy]-1,3-benzodithiol-4-yl]oxy]ethoxy]ethyl 2-methylbutanoate (PubChem CID 176804742) has the molecular formula C29H38N2O7S2 and a molecular weight of 590.76 g/mol. Its IUPAC name is 2-[2-[[(2E)-2-[cyano(isocyano)methylidene]-5-methyl-7-[2-(4-methyl-3-oxohexoxy)ethoxy]-1,3-benzodithiol-4-yl]oxy]ethoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2-[[(2E)-2-[cyano(isocyano)methylidene]-5-methyl-7-[2-(4-methyl-3-oxohexoxy)ethoxy]-1,3-benzodithiol-4-yl]oxy]ethoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 176804742 |
| Molecular Formula | C29H38N2O7S2 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 2-[2-[[(2E)-2-[cyano(isocyano)methylidene]-5-methyl-7-[2-(4-methyl-3-oxohexoxy)ethoxy]-1,3-benzodithiol-4-yl]oxy]ethoxy]ethyl 2-methylbutanoate |
| SMILES | [C-]#[N+]/C(C#N)=C1\Sc2c(OCCOCCC(=O)C(C)CC)cc(C)c(OCCOCCOC(=O)C(C)CC)c2S1 |
| InChI | InChI=1S/C29H38N2O7S2/c1-7-19(3)23(32)9-10-34-11-14-36-24-17-21(5)25(27-26(24)39-29(40-27)22(18-30)31-6)37-15-12-35-13-16-38-28(33)20(4)8-2/h17,19-20H,7-16H2,1-5H3/b29-22+ |
| InChIKey | MGJKRDTTXSDHPX-QUPMIFSKSA-N |
| XLogP | 6.19 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|