C28H32N2O6S4 — CID 59448877
propan-2-yl 2-cyano-2-[4,8-dibutoxy-2-(1-isocyano-2-oxo-2-propan-2-yloxyethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate (PubChem CID 59448877) has the molecular formula C28H32N2O6S4 and a molecular weight of 620.84 g/mol. Its IUPAC name is propan-2-yl 2-cyano-2-[4,8-dibutoxy-2-(1-isocyano-2-oxo-2-propan-2-yloxyethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate.
| Compound Name | propan-2-yl 2-cyano-2-[4,8-dibutoxy-2-(1-isocyano-2-oxo-2-propan-2-yloxyethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
|---|---|
| PubChem CID | 59448877 |
| Molecular Formula | C28H32N2O6S4 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | propan-2-yl 2-cyano-2-[4,8-dibutoxy-2-(1-isocyano-2-oxo-2-propan-2-yloxyethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
| SMILES | [C-]#[N+]C(C(=O)OC(C)C)=C1Sc2c(OCCCC)c3c(c(OCCCC)c2S1)SC(=C(C#N)C(=O)OC(C)C)S3 |
| InChI | InChI=1S/C28H32N2O6S4/c1-8-10-12-33-19-21-22(38-27(37-21)17(14-29)25(31)35-15(3)4)20(34-13-11-9-2)24-23(19)39-28(40-24)18(30-7)26(32)36-16(5)6/h15-16H,8-13H2,1-6H3/b27-17-,28-18- |
| InChIKey | LXFVUONIHWQIIC-HJTNQMAYSA-N |
| XLogP | 8.17 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|