C24H24N2O6S4 — CID 58322112
ethyl (2E)-2-cyano-2-[(6E)-8-(2-ethoxy-2-oxoethoxy)-6-(1-isocyanopropylidene)-4-propoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate (PubChem CID 58322112) has the molecular formula C24H24N2O6S4 and a molecular weight of 564.73 g/mol. Its IUPAC name is ethyl (2E)-2-cyano-2-[(6E)-8-(2-ethoxy-2-oxoethoxy)-6-(1-isocyanopropylidene)-4-propoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-cyano-2-[(6E)-8-(2-ethoxy-2-oxoethoxy)-6-(1-isocyanopropylidene)-4-propoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate |
|---|---|
| PubChem CID | 58322112 |
| Molecular Formula | C24H24N2O6S4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | ethyl (2E)-2-cyano-2-[(6E)-8-(2-ethoxy-2-oxoethoxy)-6-(1-isocyanopropylidene)-4-propoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-2-ylidene]acetate |
| SMILES | [C-]#[N+]/C(CC)=C1\Sc2c(OCCC)c3c(c(OCC(=O)OCC)c2S1)S/C(=C(\C#N)C(=O)OCC)S3 |
| InChI | InChI=1S/C24H24N2O6S4/c1-6-10-31-16-18-20(34-23(33-18)13(11-25)22(28)30-9-4)17(32-12-15(27)29-8-3)21-19(16)35-24(36-21)14(7-2)26-5/h6-10,12H2,1-4H3/b23-13+,24-14+ |
| InChIKey | JCIFYYBZYWDGCA-RNIAWFEPSA-N |
| XLogP | 6.61 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|