C38H52N2O6S4 — CID 59171538
tert-butyl 2-[4,8-bis(2-ethylhexoxy)-2-[1-isocyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate (PubChem CID 59171538) has the molecular formula C38H52N2O6S4 and a molecular weight of 761.11 g/mol. Its IUPAC name is tert-butyl 2-[4,8-bis(2-ethylhexoxy)-2-[1-isocyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate.
| Compound Name | tert-butyl 2-[4,8-bis(2-ethylhexoxy)-2-[1-isocyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 59171538 |
| Molecular Formula | C38H52N2O6S4 |
| Molecular Weight | 761.11 g/mol |
| Exact Mass | 760.27 |
| IUPAC Name | tert-butyl 2-[4,8-bis(2-ethylhexoxy)-2-[1-isocyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate |
| SMILES | [C-]#[N+]C(C(=O)OC(C)(C)C)=C1Sc2c(OCC(CC)CCCC)c3c(c(OCC(CC)CCCC)c2S1)SC(=C(C#N)C(=O)OC(C)(C)C)S3 |
| InChI | InChI=1S/C38H52N2O6S4/c1-12-16-18-23(14-3)21-43-27-29-30(48-35(47-29)25(20-39)33(41)45-37(5,6)7)28(44-22-24(15-4)19-17-13-2)32-31(27)49-36(50-32)26(40-11)34(42)46-38(8,9)10/h23-24H,12-19,21-22H2,1-10H3/b35-25-,36-26- |
| InChIKey | YTOJSLCADRWXGO-SDURLSCFSA-N |
| XLogP | 11.78 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.11 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|