C22H20N2O6S4 — CID 88895712
tert-butyl 2-cyano-2-[2-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate (PubChem CID 88895712) has the molecular formula C22H20N2O6S4 and a molecular weight of 536.68 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-[2-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate.
| Compound Name | tert-butyl 2-cyano-2-[2-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
|---|---|
| PubChem CID | 88895712 |
| Molecular Formula | C22H20N2O6S4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | tert-butyl 2-cyano-2-[2-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]-4,8-dihydroxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)C(C#N)=C1Sc2c(O)c3c(c(O)c2S1)SC(=C(C#N)C(=O)OC(C)(C)C)S3 |
| InChI | InChI=1S/C22H20N2O6S4/c1-21(2,3)29-17(27)9(7-23)19-31-13-11(25)15-16(12(26)14(13)32-19)34-20(33-15)10(8-24)18(28)30-22(4,5)6/h25-26H,1-6H3/b19-9-,20-10- |
| InChIKey | CZGCXAYOFDYJTF-QJUDHZBZSA-N |
| XLogP | 5.65 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|