C16H24N2O2 — CID 5376275
tert-butyl (2Z)-2-(2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-ylidene)-2-cyanoacetate (PubChem CID 5376275) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl (2Z)-2-(2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-ylidene)-2-cyanoacetate.
| Compound Name | tert-butyl (2Z)-2-(2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-ylidene)-2-cyanoacetate |
|---|---|
| PubChem CID | 5376275 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | tert-butyl (2Z)-2-(2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-ylidene)-2-cyanoacetate |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=C1/CC2CCCCC2CN1 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,3)20-15(19)13(9-17)14-8-11-6-4-5-7-12(11)10-18-14/h11-12,18H,4-8,10H2,1-3H3/b14-13- |
| InChIKey | APFSMTCAOQXPPR-YPKPFQOOSA-N |
| XLogP | 2.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|