C22H30N4O4 — CID 6147627
tert-butyl (2Z)-2-cyano-2-[5-[(5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidin-2-yl]pyrrolidin-2-ylidene]acetate (PubChem CID 6147627) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl (2Z)-2-cyano-2-[5-[(5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidin-2-yl]pyrrolidin-2-ylidene]acetate.
| Compound Name | tert-butyl (2Z)-2-cyano-2-[5-[(5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidin-2-yl]pyrrolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 6147627 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl (2Z)-2-cyano-2-[5-[(5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidin-2-yl]pyrrolidin-2-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)/C(C#N)=C1/CCC(C2CC/C(=C(/C#N)C(=O)OC(C)(C)C)N2)N1 |
| InChI | InChI=1S/C22H30N4O4/c1-21(2,3)29-19(27)13(11-23)15-7-9-17(25-15)18-10-8-16(26-18)14(12-24)20(28)30-22(4,5)6/h17-18,25-26H,7-10H2,1-6H3/b15-13-,16-14+ |
| InChIKey | MQYOUGDNKUGORR-VCFJNTAESA-N |
| XLogP | 2.73 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|