C13H18N2O4 — CID 92857548
methyl (2R,5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-2-carboxylate (PubChem CID 92857548) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl (2R,5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 92857548 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl (2R,5E)-5-[1-cyano-2-[(2-methylpropan-2-yl)oxy]-2-oxoethylidene]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC/C(=C(/C#N)C(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C13H18N2O4/c1-13(2,3)19-11(16)8(7-14)9-5-6-10(15-9)12(17)18-4/h10,15H,5-6H2,1-4H3/b9-8+/t10-/m1/s1 |
| InChIKey | MJLDOQIIMPWYAI-AAXQSMANSA-N |
| XLogP | 1.03 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|