C30H40N2O6S6 — CID 59171572
2-[4,8-bis(2-ethylhexoxy)-2-[isocyano(methylsulfonyl)methylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-methylsulfonylacetonitrile (PubChem CID 59171572) has the molecular formula C30H40N2O6S6 and a molecular weight of 717.06 g/mol. Its IUPAC name is 2-[4,8-bis(2-ethylhexoxy)-2-[isocyano(methylsulfonyl)methylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-methylsulfonylacetonitrile.
| Compound Name | 2-[4,8-bis(2-ethylhexoxy)-2-[isocyano(methylsulfonyl)methylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-methylsulfonylacetonitrile |
|---|---|
| PubChem CID | 59171572 |
| Molecular Formula | C30H40N2O6S6 |
| Molecular Weight | 717.06 g/mol |
| Exact Mass | 716.12 |
| IUPAC Name | 2-[4,8-bis(2-ethylhexoxy)-2-[isocyano(methylsulfonyl)methylidene]-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-methylsulfonylacetonitrile |
| SMILES | [C-]#[N+]C(=C1Sc2c(OCC(CC)CCCC)c3c(c(OCC(CC)CCCC)c2S1)SC(=C(C#N)S(C)(=O)=O)S3)S(C)(=O)=O |
| InChI | InChI=1S/C30H40N2O6S6/c1-8-12-14-19(10-3)17-37-22-24-25(40-29(39-24)21(16-31)43(6,33)34)23(38-18-20(11-4)15-13-9-2)27-26(22)41-30(42-27)28(32-5)44(7,35)36/h19-20H,8-15,17-18H2,1-4,6-7H3/b29-21-,30-28+ |
| InChIKey | PNOIOHWAIHWRRY-CSIPTEJJSA-N |
| XLogP | 9.10 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.06 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|