About 2-ethylhexyl 1-aminoethanesulfonate
2-ethylhexyl 1-aminoethanesulfonate (PubChem CID 174411439) has the molecular formula C10H23NO3S
and a molecular weight of 237.36 g/mol. Its IUPAC name is 2-ethylhexyl 1-aminoethanesulfonate.
Molecular Properties
| Compound Name | 2-ethylhexyl 1-aminoethanesulfonate |
| PubChem CID | 174411439 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-ethylhexyl 1-aminoethanesulfonate |
| SMILES | CCCCC(CC)COS(=O)(=O)C(C)N |
| InChI | InChI=1S/C10H23NO3S/c1-4-6-7-10(5-2)8-14-15(12,13)9(3)11/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | DUCDCRSLWQIXPI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl 1-aminoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 1-aminoethanesulfonate?
The IUPAC name of 2-ethylhexyl 1-aminoethanesulfonate (CID 174411439) is 2-ethylhexyl 1-aminoethanesulfonate.
What is the SMILES notation for 2-ethylhexyl 1-aminoethanesulfonate?
The canonical SMILES for 2-ethylhexyl 1-aminoethanesulfonate is CCCCC(CC)COS(=O)(=O)C(C)N.
What is the InChIKey of 2-ethylhexyl 1-aminoethanesulfonate?
The InChIKey is DUCDCRSLWQIXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO3S/c1-4-6-7-10(5-2)8-14-15(12,13)9(3)11/h9-10H,4-8,11H2,1-3H3.
What are the key properties of 2-ethylhexyl 1-aminoethanesulfonate?
2-ethylhexyl 1-aminoethanesulfonate has a molecular weight of 237.36 g/mol, XLogP of 1.85, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 1-aminoethanesulfonate is sourced from PubChem (CID 174411439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).