2-ethylhexyl methyl sulfate

C9H20O4S — CID 87904798

IUPAC2-ethylhexyl methyl sulfate
SMILESCCCCC(CC)COS(=O)(=O)OC
InChIInChI=1S/C9H20O4S/c1-4-6-7-9(5-2)8-13-14(10,11)12-3/h9H,4-8H2,1-3H3
InChIKeyFULCYFKUXDQSDR-UHFFFAOYSA-N
MW224.32 g/mol
LogP2.11
Rot. Bonds8

About 2-ethylhexyl methyl sulfate

2-ethylhexyl methyl sulfate (PubChem CID 87904798) has the molecular formula C9H20O4S and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-ethylhexyl methyl sulfate.

Molecular Properties

Compound Name2-ethylhexyl methyl sulfate
PubChem CID87904798
Molecular FormulaC9H20O4S
Molecular Weight224.32 g/mol
Exact Mass224.11
IUPAC Name2-ethylhexyl methyl sulfate
SMILESCCCCC(CC)COS(=O)(=O)OC
InChIInChI=1S/C9H20O4S/c1-4-6-7-9(5-2)8-13-14(10,11)12-3/h9H,4-8H2,1-3H3
InChIKeyFULCYFKUXDQSDR-UHFFFAOYSA-N
XLogP2.11
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.32
LogP ≤ 52.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-ethylhexyl methyl sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylhexyl methyl sulfate?
The IUPAC name of 2-ethylhexyl methyl sulfate (CID 87904798) is 2-ethylhexyl methyl sulfate.
What is the SMILES notation for 2-ethylhexyl methyl sulfate?
The canonical SMILES for 2-ethylhexyl methyl sulfate is CCCCC(CC)COS(=O)(=O)OC.
What is the InChIKey of 2-ethylhexyl methyl sulfate?
The InChIKey is FULCYFKUXDQSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4S/c1-4-6-7-9(5-2)8-13-14(10,11)12-3/h9H,4-8H2,1-3H3.
What are the key properties of 2-ethylhexyl methyl sulfate?
2-ethylhexyl methyl sulfate has a molecular weight of 224.32 g/mol, XLogP of 2.11, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl methyl sulfate is sourced from PubChem (CID 87904798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).