C40H46O10S6 — CID 59449138
2-[2-[benzenesulfonyl(carboxy)methylidene]-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-phenylperoxysulfanylacetic acid (PubChem CID 59449138) has the molecular formula C40H46O10S6 and a molecular weight of 879.20 g/mol. Its IUPAC name is 2-[2-[benzenesulfonyl(carboxy)methylidene]-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-phenylperoxysulfanylacetic acid.
| Compound Name | 2-[2-[benzenesulfonyl(carboxy)methylidene]-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-phenylperoxysulfanylacetic acid |
|---|---|
| PubChem CID | 59449138 |
| Molecular Formula | C40H46O10S6 |
| Molecular Weight | 879.20 g/mol |
| Exact Mass | 878.14 |
| IUPAC Name | 2-[2-[benzenesulfonyl(carboxy)methylidene]-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-phenylperoxysulfanylacetic acid |
| SMILES | CCCCC(CC)COc1c2c(c(OCC(CC)CCCC)c3c1SC(=C(C(=O)O)S(=O)(=O)c1ccccc1)S3)SC(=C(SOOc1ccccc1)C(=O)O)S2 |
| InChI | InChI=1S/C40H46O10S6/c1-5-9-17-25(7-3)23-47-29-31-32(52-39(51-31)35(37(41)42)55-50-49-27-19-13-11-14-20-27)30(48-24-26(8-4)18-10-6-2)34-33(29)53-40(54-34)36(38(43)44)56(45,46)28-21-15-12-16-22-28/h11-16,19-22,25-26H,5-10,17-18,23-24H2,1-4H3,(H,41,42)(H,43,44)/b39-35-,40-36- |
| InChIKey | JTQPVCHWIPEOQK-OVTCTGMWSA-N |
| XLogP | 11.91 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.20 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|