C36H34N2O8S5 — CID 59171582
[(6E)-6-(2-amino-1-isocyano-2-oxoethylidene)-2-[1-(benzenesulfonyl)-2-ethoxy-2-oxoethylidene]-4-phenylmethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-ethylhexanoate (PubChem CID 59171582) has the molecular formula C36H34N2O8S5 and a molecular weight of 783.01 g/mol. Its IUPAC name is [(6E)-6-(2-amino-1-isocyano-2-oxoethylidene)-2-[1-(benzenesulfonyl)-2-ethoxy-2-oxoethylidene]-4-phenylmethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-ethylhexanoate.
| Compound Name | [(6E)-6-(2-amino-1-isocyano-2-oxoethylidene)-2-[1-(benzenesulfonyl)-2-ethoxy-2-oxoethylidene]-4-phenylmethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 59171582 |
| Molecular Formula | C36H34N2O8S5 |
| Molecular Weight | 783.01 g/mol |
| Exact Mass | 782.09 |
| IUPAC Name | [(6E)-6-(2-amino-1-isocyano-2-oxoethylidene)-2-[1-(benzenesulfonyl)-2-ethoxy-2-oxoethylidene]-4-phenylmethoxy-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl] 2-ethylhexanoate |
| SMILES | [C-]#[N+]/C(C(N)=O)=C1\Sc2c(OCc3ccccc3)c3c(c(OC(=O)C(CC)CCCC)c2S1)SC(=C(C(=O)OCC)S(=O)(=O)c1ccccc1)S3 |
| InChI | InChI=1S/C36H34N2O8S5/c1-5-8-17-22(6-2)33(40)46-26-29-27(47-35(48-29)24(38-4)32(37)39)25(45-20-21-15-11-9-12-16-21)28-30(26)50-36(49-28)31(34(41)44-7-3)51(42,43)23-18-13-10-14-19-23/h9-16,18-19,22H,5-8,17,20H2,1-3H3,(H2,37,39)/b35-24+,36-31? |
| InChIKey | YKRVSXHKDDWLQD-SKDCXPQVSA-N |
| XLogP | 8.56 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.01 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|