C48H68N2O10S4 — CID 59449116
octyl 2-[4,8-bis(2-ethylhexoxycarbonyloxy)-2-(1-isocyano-2-octoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate (PubChem CID 59449116) has the molecular formula C48H68N2O10S4 and a molecular weight of 961.34 g/mol. Its IUPAC name is octyl 2-[4,8-bis(2-ethylhexoxycarbonyloxy)-2-(1-isocyano-2-octoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate.
| Compound Name | octyl 2-[4,8-bis(2-ethylhexoxycarbonyloxy)-2-(1-isocyano-2-octoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 59449116 |
| Molecular Formula | C48H68N2O10S4 |
| Molecular Weight | 961.34 g/mol |
| Exact Mass | 960.38 |
| IUPAC Name | octyl 2-[4,8-bis(2-ethylhexoxycarbonyloxy)-2-(1-isocyano-2-octoxy-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]-2-cyanoacetate |
| SMILES | [C-]#[N+]C(C(=O)OCCCCCCCC)=C1Sc2c(OC(=O)OCC(CC)CCCC)c3c(c(OC(=O)OCC(CC)CCCC)c2S1)SC(=C(C#N)C(=O)OCCCCCCCC)S3 |
| InChI | InChI=1S/C48H68N2O10S4/c1-8-14-18-20-22-24-28-55-43(51)35(30-49)45-61-39-37(59-47(53)57-31-33(12-5)26-16-10-3)41-42(38(40(39)62-45)60-48(54)58-32-34(13-6)27-17-11-4)64-46(63-41)36(50-7)44(52)56-29-25-23-21-19-15-9-2/h33-34H,8-29,31-32H2,1-6H3/b45-35-,46-36- |
| InChIKey | NHMHMNATSFHGEZ-RYMWFAGJSA-N |
| XLogP | 15.18 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.34 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|