C24H22N2O7S4 — CID 89065707
[8-butoxycarbonyloxy-6-(1-cyanoethylidene)-2-(1-cyano-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] butyl carbonate (PubChem CID 89065707) has the molecular formula C24H22N2O7S4 and a molecular weight of 578.72 g/mol. Its IUPAC name is [8-butoxycarbonyloxy-6-(1-cyanoethylidene)-2-(1-cyano-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] butyl carbonate.
| Compound Name | [8-butoxycarbonyloxy-6-(1-cyanoethylidene)-2-(1-cyano-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] butyl carbonate |
|---|---|
| PubChem CID | 89065707 |
| Molecular Formula | C24H22N2O7S4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.03 |
| IUPAC Name | [8-butoxycarbonyloxy-6-(1-cyanoethylidene)-2-(1-cyano-2-oxoethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] butyl carbonate |
| SMILES | CCCCOC(=O)Oc1c2c(c(OC(=O)OCCCC)c3c1SC(=C(C#N)C=O)S3)SC(=C(C)C#N)S2 |
| InChI | InChI=1S/C24H22N2O7S4/c1-4-6-8-30-23(28)32-15-17-18(35-21(34-17)13(3)10-25)16(33-24(29)31-9-7-5-2)20-19(15)36-22(37-20)14(11-26)12-27/h12H,4-9H2,1-3H3/b21-13-,22-14- |
| InChIKey | DTSHYLWJWUENGI-JZTLMNBPSA-N |
| XLogP | 7.40 |
| TPSA | 135.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|