C19H21NO5S2 — CID 89176025
(3-hydroxy-3-methylbutyl) (2E)-2-cyano-2-(7-methyl-4-propanoyloxy-1,3-benzodithiol-2-ylidene)acetate (PubChem CID 89176025) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is (3-hydroxy-3-methylbutyl) (2E)-2-cyano-2-(7-methyl-4-propanoyloxy-1,3-benzodithiol-2-ylidene)acetate.
| Compound Name | (3-hydroxy-3-methylbutyl) (2E)-2-cyano-2-(7-methyl-4-propanoyloxy-1,3-benzodithiol-2-ylidene)acetate |
|---|---|
| PubChem CID | 89176025 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (3-hydroxy-3-methylbutyl) (2E)-2-cyano-2-(7-methyl-4-propanoyloxy-1,3-benzodithiol-2-ylidene)acetate |
| SMILES | CCC(=O)Oc1ccc(C)c2c1S/C(=C(\C#N)C(=O)OCCC(C)(C)O)S2 |
| InChI | InChI=1S/C19H21NO5S2/c1-5-14(21)25-13-7-6-11(2)15-16(13)27-18(26-15)12(10-20)17(22)24-9-8-19(3,4)23/h6-7,23H,5,8-9H2,1-4H3/b18-12+ |
| InChIKey | PJKYGZHESSRGPV-LDADJPATSA-N |
| XLogP | 3.95 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|