C32H43NO5S2 — CID 123375810
[(2E)-2-[1-isocyano-2-(3-methoxy-3-methylbutoxy)-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 123375810) has the molecular formula C32H43NO5S2 and a molecular weight of 585.83 g/mol. Its IUPAC name is [(2E)-2-[1-isocyano-2-(3-methoxy-3-methylbutoxy)-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [(2E)-2-[1-isocyano-2-(3-methoxy-3-methylbutoxy)-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123375810 |
| Molecular Formula | C32H43NO5S2 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | [(2E)-2-[1-isocyano-2-(3-methoxy-3-methylbutoxy)-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | [C-]#[N+]/C(C(=O)OCCC(C)(C)OC)=C1\Sc2c(C)ccc(OC(=O)C3CCC(C4CCC(CC)CC4)CC3)c2S1 |
| InChI | InChI=1S/C32H43NO5S2/c1-7-21-9-11-22(12-10-21)23-13-15-24(16-14-23)29(34)38-25-17-8-20(2)27-28(25)40-31(39-27)26(33-5)30(35)37-19-18-32(3,4)36-6/h8,17,21-24H,7,9-16,18-19H2,1-4,6H3/b31-26+ |
| InChIKey | PIXHFAGTFBOHHR-GKPLWNPISA-N |
| XLogP | 8.57 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|