C31H41NO5S2 — CID 76625034
[2-[2-(3-hydroxy-3-methylbutoxy)-1-isocyano-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 76625034) has the molecular formula C31H41NO5S2 and a molecular weight of 571.81 g/mol. Its IUPAC name is [2-[2-(3-hydroxy-3-methylbutoxy)-1-isocyano-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [2-[2-(3-hydroxy-3-methylbutoxy)-1-isocyano-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 76625034 |
| Molecular Formula | C31H41NO5S2 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | [2-[2-(3-hydroxy-3-methylbutoxy)-1-isocyano-2-oxoethylidene]-7-methyl-1,3-benzodithiol-4-yl] 4-(4-ethylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | [C-]#[N+]C(C(=O)OCCC(C)(C)O)=C1Sc2c(C)ccc(OC(=O)C3CCC(C4CCC(CC)CC4)CC3)c2S1 |
| InChI | InChI=1S/C31H41NO5S2/c1-6-20-8-10-21(11-9-20)22-12-14-23(15-13-22)28(33)37-24-16-7-19(2)26-27(24)39-30(38-26)25(32-5)29(34)36-18-17-31(3,4)35/h7,16,20-23,35H,6,8-15,17-18H2,1-4H3 |
| InChIKey | RABHRZQJZUQRRC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|