C32H42O7S2 — CID 59501868
[2-(1-ethoxy-4,4-dimethyl-1,3-dioxopentan-2-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate (PubChem CID 59501868) has the molecular formula C32H42O7S2 and a molecular weight of 602.82 g/mol. Its IUPAC name is [2-(1-ethoxy-4,4-dimethyl-1,3-dioxopentan-2-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2-(1-ethoxy-4,4-dimethyl-1,3-dioxopentan-2-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59501868 |
| Molecular Formula | C32H42O7S2 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | [2-(1-ethoxy-4,4-dimethyl-1,3-dioxopentan-2-ylidene)-4-(4-methylcyclohexanecarbonyl)oxy-1,3-benzodithiol-7-yl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C(C(=O)C(C)(C)C)=C1Sc2c(OC(=O)C3CCC(C)CC3)ccc(OC(=O)C3CCC(C)CC3)c2S1 |
| InChI | InChI=1S/C32H42O7S2/c1-7-37-30(36)24(27(33)32(4,5)6)31-40-25-22(38-28(34)20-12-8-18(2)9-13-20)16-17-23(26(25)41-31)39-29(35)21-14-10-19(3)11-15-21/h16-21H,7-15H2,1-6H3 |
| InChIKey | ROVCTDFPUZCHQY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|